Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 88150-75-8, Name is Ethyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate, SMILES is O=C(OCC)CC(COCCN(C(C1=C2C=CC=C1)=O)C2=O)=O, belongs to indolines-derivatives compound. In a document, author is Zhi, Changlei, introduce the new discover, Recommanded Product: Ethyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate.
Cu-Catalyzed Direct C7 Sulfonylation of Indolines with Arylsulfonyl Chlorides
An efficient Cu-catalyzed direct sulfonylation of indolines with easily accessible sulfonyl chlorides has been realized under an air atmosphere via a chelation-assisted strategy. This protocol exhibits several unique characteristics, including broad substrate scope, good functional group tolerance, and operational convenience, which enable a regioselective access to a variety of C-7 functionalized indoline scaffolds in moderate to good yields. The mechanistic study reveals that the sulfonyl radical might be involved in this transformation.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 88150-75-8 is helpful to your research. Recommanded Product: Ethyl 4-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)-3-oxobutanoate.